Structure and magnetic properties of layered high-spin Co(II)(L-threonine)2(H2O)2

We report the structure and the magnetic properties of a cobalt(II) compound with the amino acid l-threonine, Co(C(4)H(8)NO(3))(2)(H(2)O)(2). It crystallizes in the orthorhombic chiral space group C222(1), with a = 5.843(5) A, b = 10.120(10) A, c = 22.36(

Detalles Bibliográficos
Autor: Rizzi, AC Brondino, CD Calvo, R Baggio, R Garland, MT Rapp, RE
Tipo de recurso: artículo
Estado:Versión publicada
Fecha de publicación:2003
País:Chile
Idioma:inglés
OAI Identifier:oai:repositorio.anid.cl:10533/240421
Acceso en línea:https://hdl.handle.net/10533/240421
Access Level:acceso abierto
Descripción
Sumario:We report the structure and the magnetic properties of a cobalt(II) compound with the amino acid l-threonine, Co(C(4)H(8)NO(3))(2)(H(2)O)(2). It crystallizes in the orthorhombic chiral space group C222(1), with a = 5.843(5) A, b = 10.120(10) A, c = 22.36(