Structure and magnetic properties of layered high-spin Co(II)(L-threonine)2(H2O)2
We report the structure and the magnetic properties of a cobalt(II) compound with the amino acid l-threonine, Co(C(4)H(8)NO(3))(2)(H(2)O)(2). It crystallizes in the orthorhombic chiral space group C222(1), with a = 5.843(5) A, b = 10.120(10) A, c = 22.36(
| Autor: | |
|---|---|
| Tipo de recurso: | artículo |
| Estado: | Versión publicada |
| Fecha de publicación: | 2003 |
| País: | Chile |
| Idioma: | inglés |
| OAI Identifier: | oai:repositorio.anid.cl:10533/240421 |
| Acceso en línea: | https://hdl.handle.net/10533/240421 |
| Access Level: | acceso abierto |
| Sumario: | We report the structure and the magnetic properties of a cobalt(II) compound with the amino acid l-threonine, Co(C(4)H(8)NO(3))(2)(H(2)O)(2). It crystallizes in the orthorhombic chiral space group C222(1), with a = 5.843(5) A, b = 10.120(10) A, c = 22.36( |
|---|